C17H20N4O4S — CID 157470076
N-(2,3-dihydro-1H-indol-5-yl)methanesulfonamide;5-nitro-2,3-dihydro-1H-indole (PubChem CID 157470076) has the molecular formula C17H20N4O4S and a molecular weight of 376.44 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-indol-5-yl)methanesulfonamide;5-nitro-2,3-dihydro-1H-indole.
| Compound Name | N-(2,3-dihydro-1H-indol-5-yl)methanesulfonamide;5-nitro-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 157470076 |
| Molecular Formula | C17H20N4O4S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | N-(2,3-dihydro-1H-indol-5-yl)methanesulfonamide;5-nitro-2,3-dihydro-1H-indole |
| SMILES | CS(=O)(=O)Nc1ccc2c(c1)CCN2.O=[N+]([O-])c1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C9H12N2O2S.C8H8N2O2/c1-14(12,13)11-8-2-3-9-7(6-8)4-5-10-9;11-10(12)7-1-2-8-6(5-7)3-4-9-8/h2-3,6,10-11H,4-5H2,1H3;1-2,5,9H,3-4H2 |
| InChIKey | BUXTZTJOUSIMFN-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|