C14H13IN2O2S — CID 28976761
N-(4-iodophenyl)-2,3-dihydro-1H-indole-5-sulfonamide (PubChem CID 28976761) has the molecular formula C14H13IN2O2S and a molecular weight of 400.24 g/mol. Its IUPAC name is N-(4-iodophenyl)-2,3-dihydro-1H-indole-5-sulfonamide.
| Compound Name | N-(4-iodophenyl)-2,3-dihydro-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 28976761 |
| Molecular Formula | C14H13IN2O2S |
| Molecular Weight | 400.24 g/mol |
| Exact Mass | 399.97 |
| IUPAC Name | N-(4-iodophenyl)-2,3-dihydro-1H-indole-5-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(I)cc1)c1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C14H13IN2O2S/c15-11-1-3-12(4-2-11)17-20(18,19)13-5-6-14-10(9-13)7-8-16-14/h1-6,9,16-17H,7-8H2 |
| InChIKey | GVMIGLBQOJDLEH-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.24 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|