C12H19N3O2S — CID 114815982
N-(2-methylpropylsulfamoyl)-2,3-dihydro-1H-indol-5-amine (PubChem CID 114815982) has the molecular formula C12H19N3O2S and a molecular weight of 269.37 g/mol. Its IUPAC name is N-(2-methylpropylsulfamoyl)-2,3-dihydro-1H-indol-5-amine.
| Compound Name | N-(2-methylpropylsulfamoyl)-2,3-dihydro-1H-indol-5-amine |
|---|---|
| PubChem CID | 114815982 |
| Molecular Formula | C12H19N3O2S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | N-(2-methylpropylsulfamoyl)-2,3-dihydro-1H-indol-5-amine |
| SMILES | CC(C)CNS(=O)(=O)Nc1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C12H19N3O2S/c1-9(2)8-14-18(16,17)15-11-3-4-12-10(7-11)5-6-13-12/h3-4,7,9,13-15H,5-6,8H2,1-2H3 |
| InChIKey | OXQRIHQUTDDQLE-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |