C16H11N3O6 — CID 15206065
1,4,11-trinitrotetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9(14),10,12-hexaene (PubChem CID 15206065) has the molecular formula C16H11N3O6 and a molecular weight of 341.28 g/mol. Its IUPAC name is 1,4,11-trinitrotetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9(14),10,12-hexaene.
| Compound Name | 1,4,11-trinitrotetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9(14),10,12-hexaene |
|---|---|
| PubChem CID | 15206065 |
| Molecular Formula | C16H11N3O6 |
| Molecular Weight | 341.28 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | 1,4,11-trinitrotetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9(14),10,12-hexaene |
| SMILES | O=[N+]([O-])c1ccc2c(c1)C1CCC2([N+](=O)[O-])c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C16H11N3O6/c20-17(21)9-2-4-14-13(7-9)11-5-6-16(14,19(24)25)15-8-10(18(22)23)1-3-12(11)15/h1-4,7-8,11H,5-6H2 |
| InChIKey | FMVMIIQRDVAWPT-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 129.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.28 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|