C13H14ClN3O3S — CID 88532235
1-(2-chloro-5-isothiocyanato-4-nitrophenyl)-2-(methoxymethyl)pyrrolidine (PubChem CID 88532235) has the molecular formula C13H14ClN3O3S and a molecular weight of 327.79 g/mol. Its IUPAC name is 1-(2-chloro-5-isothiocyanato-4-nitrophenyl)-2-(methoxymethyl)pyrrolidine.
| Compound Name | 1-(2-chloro-5-isothiocyanato-4-nitrophenyl)-2-(methoxymethyl)pyrrolidine |
|---|---|
| PubChem CID | 88532235 |
| Molecular Formula | C13H14ClN3O3S |
| Molecular Weight | 327.79 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | 1-(2-chloro-5-isothiocyanato-4-nitrophenyl)-2-(methoxymethyl)pyrrolidine |
| SMILES | COCC1CCCN1c1cc(N=C=S)c([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C13H14ClN3O3S/c1-20-7-9-3-2-4-16(9)12-6-11(15-8-21)13(17(18)19)5-10(12)14/h5-6,9H,2-4,7H2,1H3 |
| InChIKey | ADBZNAMFIXJQCA-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 67.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.79 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|