C25H26Cl2F3N5O4S — CID 86674356
N-[[4-chloro-3-[[4-chloro-5-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-nitrophenyl]carbamothioylamino]phenyl]methyl]-1-(trifluoromethyl)cyclopropane-1-carboxamide (PubChem CID 86674356) has the molecular formula C25H26Cl2F3N5O4S and a molecular weight of 620.48 g/mol. Its IUPAC name is N-[[4-chloro-3-[[4-chloro-5-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-nitrophenyl]carbamothioylamino]phenyl]methyl]-1-(trifluoromethyl)cyclopropane-1-carboxamide.
| Compound Name | N-[[4-chloro-3-[[4-chloro-5-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-nitrophenyl]carbamothioylamino]phenyl]methyl]-1-(trifluoromethyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 86674356 |
| Molecular Formula | C25H26Cl2F3N5O4S |
| Molecular Weight | 620.48 g/mol |
| Exact Mass | 619.10 |
| IUPAC Name | N-[[4-chloro-3-[[4-chloro-5-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-nitrophenyl]carbamothioylamino]phenyl]methyl]-1-(trifluoromethyl)cyclopropane-1-carboxamide |
| SMILES | COC[C@@H]1CCCN1c1cc(NC(=S)Nc2cc(CNC(=O)C3(C(F)(F)F)CC3)ccc2Cl)c([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C25H26Cl2F3N5O4S/c1-39-13-15-3-2-8-34(15)20-11-19(21(35(37)38)10-17(20)27)33-23(40)32-18-9-14(4-5-16(18)26)12-31-22(36)24(6-7-24)25(28,29)30/h4-5,9-11,15H,2-3,6-8,12-13H2,1H3,(H,31,36)(H2,32,33,40)/t15-/m0/s1 |
| InChIKey | GBMZEOYKPFKLAT-HNNXBMFYSA-N |
| XLogP | 6.28 |
| TPSA | 108.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.48 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|