C7H10O2 — CID 91539474
3,6,7,7a-tetrahydro-1H-furo[3,4-c]pyran (PubChem CID 91539474) has the molecular formula C7H10O2 and a molecular weight of 126.16 g/mol. Its IUPAC name is 3,6,7,7a-tetrahydro-1H-furo[3,4-c]pyran.
| Compound Name | 3,6,7,7a-tetrahydro-1H-furo[3,4-c]pyran |
|---|---|
| PubChem CID | 91539474 |
| Molecular Formula | C7H10O2 |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.07 |
| IUPAC Name | 3,6,7,7a-tetrahydro-1H-furo[3,4-c]pyran |
| SMILES | C1=C2COCC2CCO1 |
| InChI | InChI=1S/C7H10O2/c1-2-8-4-7-5-9-3-6(1)7/h4,6H,1-3,5H2 |
| InChIKey | XPXQUTBZNYKGAY-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |