C10H14O2 — CID 102089093
(3aS,5aR)-1,3,3a,4,5,5a,6,8-octahydrofuro[3,4-e][2]benzofuran (PubChem CID 102089093) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is (3aS,5aR)-1,3,3a,4,5,5a,6,8-octahydrofuro[3,4-e][2]benzofuran.
| Compound Name | (3aS,5aR)-1,3,3a,4,5,5a,6,8-octahydrofuro[3,4-e][2]benzofuran |
|---|---|
| PubChem CID | 102089093 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | (3aS,5aR)-1,3,3a,4,5,5a,6,8-octahydrofuro[3,4-e][2]benzofuran |
| SMILES | C1OC[C@H]2CC[C@H]3COCC3=C12 |
| InChI | InChI=1S/C10H14O2/c1-2-8-4-12-6-10(8)9-5-11-3-7(1)9/h7-8H,1-6H2/t7-,8+ |
| InChIKey | TXPXWZNPBZOGLD-OCAPTIKFSA-N |
| XLogP | 1.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|