C14H20 — CID 15863501
tetracyclo[6.2.2.23,6.02,7]tetradec-2(7)-ene (PubChem CID 15863501) has the molecular formula C14H20 and a molecular weight of 188.31 g/mol. Its IUPAC name is tetracyclo[6.2.2.23,6.02,7]tetradec-2(7)-ene.
| Compound Name | tetracyclo[6.2.2.23,6.02,7]tetradec-2(7)-ene |
|---|---|
| PubChem CID | 15863501 |
| Molecular Formula | C14H20 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | tetracyclo[6.2.2.23,6.02,7]tetradec-2(7)-ene |
| SMILES | C1CC2CCC1C1=C2C2CCC1CC2 |
| InChI | InChI=1S/C14H20/c1-2-10-4-3-9(1)13-11-5-7-12(8-6-11)14(10)13/h9-12H,1-8H2 |
| InChIKey | PZUCSGILHCSWOE-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|