C17H22 — CID 12028986
1,2,4,5-tetracyclopropylcyclopenta-1,3-diene (PubChem CID 12028986) has the molecular formula C17H22 and a molecular weight of 226.36 g/mol. Its IUPAC name is 1,2,4,5-tetracyclopropylcyclopenta-1,3-diene.
| Compound Name | 1,2,4,5-tetracyclopropylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 12028986 |
| Molecular Formula | C17H22 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 1,2,4,5-tetracyclopropylcyclopenta-1,3-diene |
| SMILES | C1=C(C2CC2)C(C2CC2)C(C2CC2)=C1C1CC1 |
| InChI | InChI=1S/C17H22/c1-2-10(1)14-9-15(11-3-4-11)17(13-7-8-13)16(14)12-5-6-12/h9-13,16H,1-8H2 |
| InChIKey | PPPAVJIYDFJUEL-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |