C28H42F2NO2 — CID 140869837
CID 140869837 (PubChem CID 140869837) has the molecular formula C28H42F2NO2 and a molecular weight of 462.65 g/mol.
| Compound Name | CID 140869837 |
|---|---|
| PubChem CID | 140869837 |
| Molecular Formula | C28H42F2NO2 |
| Molecular Weight | 462.65 g/mol |
| Exact Mass | 462.32 |
| IUPAC Name | — |
| SMILES | COC1CCC(C2CCC(c3ccc(C4CC(C)(C)N([O])C(C)(C)C4)c(F)c3F)CC2)CC1 |
| InChI | InChI=1S/C28H42F2NO2/c1-27(2)16-21(17-28(3,4)31(27)32)24-15-14-23(25(29)26(24)30)20-8-6-18(7-9-20)19-10-12-22(33-5)13-11-19/h14-15,18-22H,6-13,16-17H2,1-5H3 |
| InChIKey | AOVLCZWVMMTFKU-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 32.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.65 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |