C7H8INO2 — CID 102974663
2-iodo-4-(oxolan-3-yl)-1,3-oxazole (PubChem CID 102974663) has the molecular formula C7H8INO2 and a molecular weight of 265.05 g/mol. Its IUPAC name is 2-iodo-4-(oxolan-3-yl)-1,3-oxazole.
| Compound Name | 2-iodo-4-(oxolan-3-yl)-1,3-oxazole |
|---|---|
| PubChem CID | 102974663 |
| Molecular Formula | C7H8INO2 |
| Molecular Weight | 265.05 g/mol |
| Exact Mass | 264.96 |
| IUPAC Name | 2-iodo-4-(oxolan-3-yl)-1,3-oxazole |
| SMILES | Ic1nc(C2CCOC2)co1 |
| InChI | InChI=1S/C7H8INO2/c8-7-9-6(4-11-7)5-1-2-10-3-5/h4-5H,1-3H2 |
| InChIKey | YUSUCSRXJOPSLH-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.05 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|