C10H18N2O — CID 144669764
ethane;5-methyl-3-(oxolan-3-yl)-1H-pyrazole (PubChem CID 144669764) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is ethane;5-methyl-3-(oxolan-3-yl)-1H-pyrazole.
| Compound Name | ethane;5-methyl-3-(oxolan-3-yl)-1H-pyrazole |
|---|---|
| PubChem CID | 144669764 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | ethane;5-methyl-3-(oxolan-3-yl)-1H-pyrazole |
| SMILES | CC.Cc1cc(C2CCOC2)n[nH]1 |
| InChI | InChI=1S/C8H12N2O.C2H6/c1-6-4-8(10-9-6)7-2-3-11-5-7;1-2/h4,7H,2-3,5H2,1H3,(H,9,10);1-2H3 |
| InChIKey | LABAUTREOKLDNK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |