C7H9NO2 — CID 114763668
3-(oxolan-3-yl)-1,2-oxazole (PubChem CID 114763668) has the molecular formula C7H9NO2 and a molecular weight of 139.15 g/mol. Its IUPAC name is 3-(oxolan-3-yl)-1,2-oxazole.
| Compound Name | 3-(oxolan-3-yl)-1,2-oxazole |
|---|---|
| PubChem CID | 114763668 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | 3-(oxolan-3-yl)-1,2-oxazole |
| SMILES | c1cc(C2CCOC2)no1 |
| InChI | InChI=1S/C7H9NO2/c1-3-9-5-6(1)7-2-4-10-8-7/h2,4,6H,1,3,5H2 |
| InChIKey | UIIREUPCCCHSSM-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |