About 3-(oxolan-3-yl)-1,2-oxazole
3-(oxolan-3-yl)-1,2-oxazole (PubChem CID 114763668) has the molecular formula C7H9NO2
and a molecular weight of 139.15 g/mol. Its IUPAC name is 3-(oxolan-3-yl)-1,2-oxazole.
Molecular Properties
| Compound Name | 3-(oxolan-3-yl)-1,2-oxazole |
| PubChem CID | 114763668 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | 3-(oxolan-3-yl)-1,2-oxazole |
| SMILES | c1cc(C2CCOC2)no1 |
| InChI | InChI=1S/C7H9NO2/c1-3-9-5-6(1)7-2-4-10-8-7/h2,4,6H,1,3,5H2 |
| InChIKey | UIIREUPCCCHSSM-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(oxolan-3-yl)-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(oxolan-3-yl)-1,2-oxazole?
The IUPAC name of 3-(oxolan-3-yl)-1,2-oxazole (CID 114763668) is 3-(oxolan-3-yl)-1,2-oxazole.
What is the SMILES notation for 3-(oxolan-3-yl)-1,2-oxazole?
The canonical SMILES for 3-(oxolan-3-yl)-1,2-oxazole is c1cc(C2CCOC2)no1.
What is the InChIKey of 3-(oxolan-3-yl)-1,2-oxazole?
The InChIKey is UIIREUPCCCHSSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO2/c1-3-9-5-6(1)7-2-4-10-8-7/h2,4,6H,1,3,5H2.
What are the key properties of 3-(oxolan-3-yl)-1,2-oxazole?
3-(oxolan-3-yl)-1,2-oxazole has a molecular weight of 139.15 g/mol, XLogP of 1.18, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(oxolan-3-yl)-1,2-oxazole is sourced from PubChem (CID 114763668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).