C8H11NO3 — CID 45099358
[3-(oxolan-3-yl)-1,2-oxazol-5-yl]methanol (PubChem CID 45099358) has the molecular formula C8H11NO3 and a molecular weight of 169.18 g/mol. Its IUPAC name is [3-(oxolan-3-yl)-1,2-oxazol-5-yl]methanol.
| Compound Name | [3-(oxolan-3-yl)-1,2-oxazol-5-yl]methanol |
|---|---|
| PubChem CID | 45099358 |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | [3-(oxolan-3-yl)-1,2-oxazol-5-yl]methanol |
| SMILES | OCc1cc(C2CCOC2)no1 |
| InChI | InChI=1S/C8H11NO3/c10-4-7-3-8(9-12-7)6-1-2-11-5-6/h3,6,10H,1-2,4-5H2 |
| InChIKey | NGGNYSKGBUYBQU-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |