About [3-[[3-(oxolan-3-yl)-1,2-oxazol-5-yl]methyl]piperidin-3-yl]-piperidin-1-ylmethanone
[3-[[3-(oxolan-3-yl)-1,2-oxazol-5-yl]methyl]piperidin-3-yl]-piperidin-1-ylmethanone (PubChem CID 110234801) has the molecular formula C19H29N3O3
and a molecular weight of 347.46 g/mol. Its IUPAC name is [3-[[3-(oxolan-3-yl)-1,2-oxazol-5-yl]methyl]piperidin-3-yl]-piperidin-1-ylmethanone.
Molecular Properties
| Compound Name | [3-[[3-(oxolan-3-yl)-1,2-oxazol-5-yl]methyl]piperidin-3-yl]-piperidin-1-ylmethanone |
| PubChem CID | 110234801 |
| Molecular Formula | C19H29N3O3 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | [3-[[3-(oxolan-3-yl)-1,2-oxazol-5-yl]methyl]piperidin-3-yl]-piperidin-1-ylmethanone |
| SMILES | O=C(N1CCCCC1)C1(Cc2cc(C3CCOC3)no2)CCCNC1 |
| InChI | InChI=1S/C19H29N3O3/c23-18(22-8-2-1-3-9-22)19(6-4-7-20-14-19)12-16-11-17(21-25-16)15-5-10-24-13-15/h11,15,20H,1-10,12-14H2 |
| InChIKey | MTZDLLBKVWTPPJ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-[[3-(oxolan-3-yl)-1,2-oxazol-5-yl]methyl]piperidin-3-yl]-piperidin-1-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[[3-(oxolan-3-yl)-1,2-oxazol-5-yl]methyl]piperidin-3-yl]-piperidin-1-ylmethanone?
The IUPAC name of [3-[[3-(oxolan-3-yl)-1,2-oxazol-5-yl]methyl]piperidin-3-yl]-piperidin-1-ylmethanone (CID 110234801) is [3-[[3-(oxolan-3-yl)-1,2-oxazol-5-yl]methyl]piperidin-3-yl]-piperidin-1-ylmethanone.
What is the SMILES notation for [3-[[3-(oxolan-3-yl)-1,2-oxazol-5-yl]methyl]piperidin-3-yl]-piperidin-1-ylmethanone?
The canonical SMILES for [3-[[3-(oxolan-3-yl)-1,2-oxazol-5-yl]methyl]piperidin-3-yl]-piperidin-1-ylmethanone is O=C(N1CCCCC1)C1(Cc2cc(C3CCOC3)no2)CCCNC1.
What is the InChIKey of [3-[[3-(oxolan-3-yl)-1,2-oxazol-5-yl]methyl]piperidin-3-yl]-piperidin-1-ylmethanone?
The InChIKey is MTZDLLBKVWTPPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H29N3O3/c23-18(22-8-2-1-3-9-22)19(6-4-7-20-14-19)12-16-11-17(21-25-16)15-5-10-24-13-15/h11,15,20H,1-10,12-14H2.
What are the key properties of [3-[[3-(oxolan-3-yl)-1,2-oxazol-5-yl]methyl]piperidin-3-yl]-piperidin-1-ylmethanone?
[3-[[3-(oxolan-3-yl)-1,2-oxazol-5-yl]methyl]piperidin-3-yl]-piperidin-1-ylmethanone has a molecular weight of 347.46 g/mol, XLogP of 2.10, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[[3-(oxolan-3-yl)-1,2-oxazol-5-yl]methyl]piperidin-3-yl]-piperidin-1-ylmethanone is sourced from PubChem (CID 110234801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).