C20H31N5O2 — CID 126446357
1-[2-methyl-6-[(3R)-oxolan-3-yl]pyrimidin-4-yl]-4-piperidin-1-ylpiperidine-4-carboxamide (PubChem CID 126446357) has the molecular formula C20H31N5O2 and a molecular weight of 373.50 g/mol. Its IUPAC name is 1-[2-methyl-6-[(3R)-oxolan-3-yl]pyrimidin-4-yl]-4-piperidin-1-ylpiperidine-4-carboxamide.
| Compound Name | 1-[2-methyl-6-[(3R)-oxolan-3-yl]pyrimidin-4-yl]-4-piperidin-1-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 126446357 |
| Molecular Formula | C20H31N5O2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.25 |
| IUPAC Name | 1-[2-methyl-6-[(3R)-oxolan-3-yl]pyrimidin-4-yl]-4-piperidin-1-ylpiperidine-4-carboxamide |
| SMILES | Cc1nc([C@H]2CCOC2)cc(N2CCC(C(N)=O)(N3CCCCC3)CC2)n1 |
| InChI | InChI=1S/C20H31N5O2/c1-15-22-17(16-5-12-27-14-16)13-18(23-15)24-10-6-20(7-11-24,19(21)26)25-8-3-2-4-9-25/h13,16H,2-12,14H2,1H3,(H2,21,26)/t16-/m0/s1 |
| InChIKey | NDYBXTCMDAXGFJ-INIZCTEOSA-N |
| XLogP | 1.60 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |