C14H22N4O — CID 126440152
1-[2-methyl-6-[(3S)-oxolan-3-yl]pyrimidin-4-yl]-1,4-diazepane (PubChem CID 126440152) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is 1-[2-methyl-6-[(3S)-oxolan-3-yl]pyrimidin-4-yl]-1,4-diazepane.
| Compound Name | 1-[2-methyl-6-[(3S)-oxolan-3-yl]pyrimidin-4-yl]-1,4-diazepane |
|---|---|
| PubChem CID | 126440152 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 1-[2-methyl-6-[(3S)-oxolan-3-yl]pyrimidin-4-yl]-1,4-diazepane |
| SMILES | Cc1nc([C@@H]2CCOC2)cc(N2CCCNCC2)n1 |
| InChI | InChI=1S/C14H22N4O/c1-11-16-13(12-3-8-19-10-12)9-14(17-11)18-6-2-4-15-5-7-18/h9,12,15H,2-8,10H2,1H3/t12-/m1/s1 |
| InChIKey | ROZYFGQUVHMFDW-GFCCVEGCSA-N |
| XLogP | 1.09 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |