About 4-methyl-3,3a-dihydro-2H-furo[2,3-b]pyridin-6-one
4-methyl-3,3a-dihydro-2H-furo[2,3-b]pyridin-6-one (PubChem CID 78177391) has the molecular formula C8H9NO2
and a molecular weight of 151.16 g/mol. Its IUPAC name is 4-methyl-3,3a-dihydro-2H-furo[2,3-b]pyridin-6-one.
Analyze 4-methyl-3,3a-dihydro-2H-furo[2,3-b]pyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3,3a-dihydro-2H-furo[2,3-b]pyridin-6-one?
The IUPAC name of 4-methyl-3,3a-dihydro-2H-furo[2,3-b]pyridin-6-one (CID 78177391) is 4-methyl-3,3a-dihydro-2H-furo[2,3-b]pyridin-6-one.
What is the SMILES notation for 4-methyl-3,3a-dihydro-2H-furo[2,3-b]pyridin-6-one?
The canonical SMILES for 4-methyl-3,3a-dihydro-2H-furo[2,3-b]pyridin-6-one is CC1=CC(=O)N=C2OCCC12.
What is the InChIKey of 4-methyl-3,3a-dihydro-2H-furo[2,3-b]pyridin-6-one?
The InChIKey is QMDXQSNNVUUPBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2/c1-5-4-7(10)9-8-6(5)2-3-11-8/h4,6H,2-3H2,1H3.
What are the key properties of 4-methyl-3,3a-dihydro-2H-furo[2,3-b]pyridin-6-one?
4-methyl-3,3a-dihydro-2H-furo[2,3-b]pyridin-6-one has a molecular weight of 151.16 g/mol, XLogP of 0.91, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3,3a-dihydro-2H-furo[2,3-b]pyridin-6-one is sourced from PubChem (CID 78177391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).