C8H16Cl2N2 — CID 19047597
1-methyl-2,3,5,6,7,7a-hexahydropyrrolo[3,4-b]pyridine;dihydrochloride (PubChem CID 19047597) has the molecular formula C8H16Cl2N2 and a molecular weight of 211.14 g/mol. Its IUPAC name is 1-methyl-2,3,5,6,7,7a-hexahydropyrrolo[3,4-b]pyridine;dihydrochloride.
| Compound Name | 1-methyl-2,3,5,6,7,7a-hexahydropyrrolo[3,4-b]pyridine;dihydrochloride |
|---|---|
| PubChem CID | 19047597 |
| Molecular Formula | C8H16Cl2N2 |
| Molecular Weight | 211.14 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | 1-methyl-2,3,5,6,7,7a-hexahydropyrrolo[3,4-b]pyridine;dihydrochloride |
| SMILES | CN1CCC=C2CNCC21.Cl.Cl |
| InChI | InChI=1S/C8H14N2.2ClH/c1-10-4-2-3-7-5-9-6-8(7)10;;/h3,8-9H,2,4-6H2,1H3;2*1H |
| InChIKey | VTLSLWFZSUSVDO-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.14 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|