C12H18N4 — CID 176569336
3-(1,2,3,6-tetrahydropyridin-5-yl)-2,3,5,6,7,7a-hexahydro-1H-pyrrolo[1,2-a]imidazole-7-carbonitrile (PubChem CID 176569336) has the molecular formula C12H18N4 and a molecular weight of 218.30 g/mol. Its IUPAC name is 3-(1,2,3,6-tetrahydropyridin-5-yl)-2,3,5,6,7,7a-hexahydro-1H-pyrrolo[1,2-a]imidazole-7-carbonitrile.
| Compound Name | 3-(1,2,3,6-tetrahydropyridin-5-yl)-2,3,5,6,7,7a-hexahydro-1H-pyrrolo[1,2-a]imidazole-7-carbonitrile |
|---|---|
| PubChem CID | 176569336 |
| Molecular Formula | C12H18N4 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 3-(1,2,3,6-tetrahydropyridin-5-yl)-2,3,5,6,7,7a-hexahydro-1H-pyrrolo[1,2-a]imidazole-7-carbonitrile |
| SMILES | N#CC1CCN2C(C3=CCCNC3)CNC12 |
| InChI | InChI=1S/C12H18N4/c13-6-9-3-5-16-11(8-15-12(9)16)10-2-1-4-14-7-10/h2,9,11-12,14-15H,1,3-5,7-8H2 |
| InChIKey | PYNFLRXWFQVSKT-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 51.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|