C12H14N4 — CID 176569213
3-(1,2,3,6-tetrahydropyridin-5-yl)-1,2,3,4-tetrahydropyrrolo[3,2-b]pyrrole-6-carbonitrile (PubChem CID 176569213) has the molecular formula C12H14N4 and a molecular weight of 214.27 g/mol. Its IUPAC name is 3-(1,2,3,6-tetrahydropyridin-5-yl)-1,2,3,4-tetrahydropyrrolo[3,2-b]pyrrole-6-carbonitrile.
| Compound Name | 3-(1,2,3,6-tetrahydropyridin-5-yl)-1,2,3,4-tetrahydropyrrolo[3,2-b]pyrrole-6-carbonitrile |
|---|---|
| PubChem CID | 176569213 |
| Molecular Formula | C12H14N4 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 3-(1,2,3,6-tetrahydropyridin-5-yl)-1,2,3,4-tetrahydropyrrolo[3,2-b]pyrrole-6-carbonitrile |
| SMILES | N#Cc1c[nH]c2c1NCC2C1=CCCNC1 |
| InChI | InChI=1S/C12H14N4/c13-4-9-6-15-12-10(7-16-11(9)12)8-2-1-3-14-5-8/h2,6,10,14-16H,1,3,5,7H2 |
| InChIKey | YFILJTGDGJESJT-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 63.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|