C10H12N2 — CID 153411022
1,2,3,4,4a,5-hexahydroisoquinoline-7-carbonitrile (PubChem CID 153411022) has the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. Its IUPAC name is 1,2,3,4,4a,5-hexahydroisoquinoline-7-carbonitrile.
| Compound Name | 1,2,3,4,4a,5-hexahydroisoquinoline-7-carbonitrile |
|---|---|
| PubChem CID | 153411022 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 1,2,3,4,4a,5-hexahydroisoquinoline-7-carbonitrile |
| SMILES | N#CC1=CCC2CCNCC2=C1 |
| InChI | InChI=1S/C10H12N2/c11-6-8-1-2-9-3-4-12-7-10(9)5-8/h1,5,9,12H,2-4,7H2 |
| InChIKey | IYCXQWHMKHYWOC-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |