C9H11N3S — CID 162341042
2-piperidin-4-yl-1,3-thiazole-4-carbonitrile (PubChem CID 162341042) has the molecular formula C9H11N3S and a molecular weight of 193.27 g/mol. Its IUPAC name is 2-piperidin-4-yl-1,3-thiazole-4-carbonitrile.
| Compound Name | 2-piperidin-4-yl-1,3-thiazole-4-carbonitrile |
|---|---|
| PubChem CID | 162341042 |
| Molecular Formula | C9H11N3S |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 2-piperidin-4-yl-1,3-thiazole-4-carbonitrile |
| SMILES | N#Cc1csc(C2CCNCC2)n1 |
| InChI | InChI=1S/C9H11N3S/c10-5-8-6-13-9(12-8)7-1-3-11-4-2-7/h6-7,11H,1-4H2 |
| InChIKey | MMGWMDFKYFEVKN-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |