C9H13N3OS — CID 66679882
2-piperidin-4-yl-1,3-thiazole-4-carboxamide (PubChem CID 66679882) has the molecular formula C9H13N3OS and a molecular weight of 211.29 g/mol. Its IUPAC name is 2-piperidin-4-yl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-piperidin-4-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 66679882 |
| Molecular Formula | C9H13N3OS |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 2-piperidin-4-yl-1,3-thiazole-4-carboxamide |
| SMILES | NC(=O)c1csc(C2CCNCC2)n1 |
| InChI | InChI=1S/C9H13N3OS/c10-8(13)7-5-14-9(12-7)6-1-3-11-4-2-6/h5-6,11H,1-4H2,(H2,10,13) |
| InChIKey | FEHYGTPISRBLFI-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |