C7H9N3OS — CID 131063820
2-cyclopropyl-1,3-thiazole-4-carbohydrazide (PubChem CID 131063820) has the molecular formula C7H9N3OS and a molecular weight of 183.24 g/mol. Its IUPAC name is 2-cyclopropyl-1,3-thiazole-4-carbohydrazide.
| Compound Name | 2-cyclopropyl-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 131063820 |
| Molecular Formula | C7H9N3OS |
| Molecular Weight | 183.24 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | 2-cyclopropyl-1,3-thiazole-4-carbohydrazide |
| SMILES | NNC(=O)c1csc(C2CC2)n1 |
| InChI | InChI=1S/C7H9N3OS/c8-10-6(11)5-3-12-7(9-5)4-1-2-4/h3-4H,1-2,8H2,(H,10,11) |
| InChIKey | SSJKFQVDKYXQCT-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.24 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|