C12H17NOS — CID 65404993
1-[2-(3-ethylcyclopentyl)-1,3-thiazol-4-yl]ethanone (PubChem CID 65404993) has the molecular formula C12H17NOS and a molecular weight of 223.34 g/mol. Its IUPAC name is 1-[2-(3-ethylcyclopentyl)-1,3-thiazol-4-yl]ethanone.
| Compound Name | 1-[2-(3-ethylcyclopentyl)-1,3-thiazol-4-yl]ethanone |
|---|---|
| PubChem CID | 65404993 |
| Molecular Formula | C12H17NOS |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 1-[2-(3-ethylcyclopentyl)-1,3-thiazol-4-yl]ethanone |
| SMILES | CCC1CCC(c2nc(C(C)=O)cs2)C1 |
| InChI | InChI=1S/C12H17NOS/c1-3-9-4-5-10(6-9)12-13-11(7-15-12)8(2)14/h7,9-10H,3-6H2,1-2H3 |
| InChIKey | IXHSPGYIEHVKPJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |