C12H17NOS — CID 65393287
2-(4-ethylcyclohexyl)-1,3-thiazole-4-carbaldehyde (PubChem CID 65393287) has the molecular formula C12H17NOS and a molecular weight of 223.34 g/mol. Its IUPAC name is 2-(4-ethylcyclohexyl)-1,3-thiazole-4-carbaldehyde.
| Compound Name | 2-(4-ethylcyclohexyl)-1,3-thiazole-4-carbaldehyde |
|---|---|
| PubChem CID | 65393287 |
| Molecular Formula | C12H17NOS |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 2-(4-ethylcyclohexyl)-1,3-thiazole-4-carbaldehyde |
| SMILES | CCC1CCC(c2nc(C=O)cs2)CC1 |
| InChI | InChI=1S/C12H17NOS/c1-2-9-3-5-10(6-4-9)12-13-11(7-14)8-15-12/h7-10H,2-6H2,1H3 |
| InChIKey | LGERNZXFYGHAAM-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|