C13H18N2S — CID 65390540
2-[2-(4-ethylcyclohexyl)-1,3-thiazol-4-yl]acetonitrile (PubChem CID 65390540) has the molecular formula C13H18N2S and a molecular weight of 234.37 g/mol. Its IUPAC name is 2-[2-(4-ethylcyclohexyl)-1,3-thiazol-4-yl]acetonitrile.
| Compound Name | 2-[2-(4-ethylcyclohexyl)-1,3-thiazol-4-yl]acetonitrile |
|---|---|
| PubChem CID | 65390540 |
| Molecular Formula | C13H18N2S |
| Molecular Weight | 234.37 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 2-[2-(4-ethylcyclohexyl)-1,3-thiazol-4-yl]acetonitrile |
| SMILES | CCC1CCC(c2nc(CC#N)cs2)CC1 |
| InChI | InChI=1S/C13H18N2S/c1-2-10-3-5-11(6-4-10)13-15-12(7-8-14)9-16-13/h9-11H,2-7H2,1H3 |
| InChIKey | DHMCQKKZSQUEAZ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.37 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |