C16H25N3OS2 — CID 89200256
4-(4-acetyl-1,3-thiazol-2-yl)-N-pentylpiperidine-1-carbothioamide (PubChem CID 89200256) has the molecular formula C16H25N3OS2 and a molecular weight of 339.53 g/mol. Its IUPAC name is 4-(4-acetyl-1,3-thiazol-2-yl)-N-pentylpiperidine-1-carbothioamide.
| Compound Name | 4-(4-acetyl-1,3-thiazol-2-yl)-N-pentylpiperidine-1-carbothioamide |
|---|---|
| PubChem CID | 89200256 |
| Molecular Formula | C16H25N3OS2 |
| Molecular Weight | 339.53 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 4-(4-acetyl-1,3-thiazol-2-yl)-N-pentylpiperidine-1-carbothioamide |
| SMILES | CCCCCNC(=S)N1CCC(c2nc(C(C)=O)cs2)CC1 |
| InChI | InChI=1S/C16H25N3OS2/c1-3-4-5-8-17-16(21)19-9-6-13(7-10-19)15-18-14(11-22-15)12(2)20/h11,13H,3-10H2,1-2H3,(H,17,21) |
| InChIKey | HWBNBODNQATOCF-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.53 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|