C18H17F4N3O2S2 — CID 3855554
ethyl 2-[1-[(2,3,5,6-tetrafluorophenyl)carbamothioyl]piperidin-4-yl]-1,3-thiazole-4-carboxylate (PubChem CID 3855554) has the molecular formula C18H17F4N3O2S2 and a molecular weight of 447.48 g/mol. Its IUPAC name is ethyl 2-[1-[(2,3,5,6-tetrafluorophenyl)carbamothioyl]piperidin-4-yl]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[1-[(2,3,5,6-tetrafluorophenyl)carbamothioyl]piperidin-4-yl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 3855554 |
| Molecular Formula | C18H17F4N3O2S2 |
| Molecular Weight | 447.48 g/mol |
| Exact Mass | 447.07 |
| IUPAC Name | ethyl 2-[1-[(2,3,5,6-tetrafluorophenyl)carbamothioyl]piperidin-4-yl]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(C2CCN(C(=S)Nc3c(F)c(F)cc(F)c3F)CC2)n1 |
| InChI | InChI=1S/C18H17F4N3O2S2/c1-2-27-17(26)12-8-29-16(23-12)9-3-5-25(6-4-9)18(28)24-15-13(21)10(19)7-11(20)14(15)22/h7-9H,2-6H2,1H3,(H,24,28) |
| InChIKey | CSHPHXZZUYVWRQ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.48 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|