C22H23N5O4S2 — CID 3752281
ethyl 5-[2-[1-[4-(carbamothioylamino)benzoyl]piperidin-4-yl]-1,3-thiazol-4-yl]-1,2-oxazole-3-carboxylate (PubChem CID 3752281) has the molecular formula C22H23N5O4S2 and a molecular weight of 485.59 g/mol. Its IUPAC name is ethyl 5-[2-[1-[4-(carbamothioylamino)benzoyl]piperidin-4-yl]-1,3-thiazol-4-yl]-1,2-oxazole-3-carboxylate.
| Compound Name | ethyl 5-[2-[1-[4-(carbamothioylamino)benzoyl]piperidin-4-yl]-1,3-thiazol-4-yl]-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 3752281 |
| Molecular Formula | C22H23N5O4S2 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | ethyl 5-[2-[1-[4-(carbamothioylamino)benzoyl]piperidin-4-yl]-1,3-thiazol-4-yl]-1,2-oxazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2csc(C3CCN(C(=O)c4ccc(NC(N)=S)cc4)CC3)n2)on1 |
| InChI | InChI=1S/C22H23N5O4S2/c1-2-30-21(29)16-11-18(31-26-16)17-12-33-19(25-17)13-7-9-27(10-8-13)20(28)14-3-5-15(6-4-14)24-22(23)32/h3-6,11-13H,2,7-10H2,1H3,(H3,23,24,32) |
| InChIKey | DEMHMPLPZSGMGA-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 123.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|