C23H23BrN4OS2 — CID 3723790
[4-[4-[4-(4-bromophenyl)-5-methyl-1,3-thiazol-2-yl]piperidine-1-carbonyl]phenyl]thiourea (PubChem CID 3723790) has the molecular formula C23H23BrN4OS2 and a molecular weight of 515.50 g/mol. Its IUPAC name is [4-[4-[4-(4-bromophenyl)-5-methyl-1,3-thiazol-2-yl]piperidine-1-carbonyl]phenyl]thiourea.
| Compound Name | [4-[4-[4-(4-bromophenyl)-5-methyl-1,3-thiazol-2-yl]piperidine-1-carbonyl]phenyl]thiourea |
|---|---|
| PubChem CID | 3723790 |
| Molecular Formula | C23H23BrN4OS2 |
| Molecular Weight | 515.50 g/mol |
| Exact Mass | 514.05 |
| IUPAC Name | [4-[4-[4-(4-bromophenyl)-5-methyl-1,3-thiazol-2-yl]piperidine-1-carbonyl]phenyl]thiourea |
| SMILES | Cc1sc(C2CCN(C(=O)c3ccc(NC(N)=S)cc3)CC2)nc1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C23H23BrN4OS2/c1-14-20(15-2-6-18(24)7-3-15)27-21(31-14)16-10-12-28(13-11-16)22(29)17-4-8-19(9-5-17)26-23(25)30/h2-9,16H,10-13H2,1H3,(H3,25,26,30) |
| InChIKey | AEVUTLZYBQXHGP-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.50 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|