C27H27BrN4O4S — CID 3729484
4-[4-[4-(4-bromophenyl)-5-methyl-1,3-thiazol-2-yl]piperidin-1-yl]-N-(4,5-dimethyl-2-nitrophenyl)-4-oxobut-2-enamide (PubChem CID 3729484) has the molecular formula C27H27BrN4O4S and a molecular weight of 583.51 g/mol. Its IUPAC name is 4-[4-[4-(4-bromophenyl)-5-methyl-1,3-thiazol-2-yl]piperidin-1-yl]-N-(4,5-dimethyl-2-nitrophenyl)-4-oxobut-2-enamide.
| Compound Name | 4-[4-[4-(4-bromophenyl)-5-methyl-1,3-thiazol-2-yl]piperidin-1-yl]-N-(4,5-dimethyl-2-nitrophenyl)-4-oxobut-2-enamide |
|---|---|
| PubChem CID | 3729484 |
| Molecular Formula | C27H27BrN4O4S |
| Molecular Weight | 583.51 g/mol |
| Exact Mass | 582.09 |
| IUPAC Name | 4-[4-[4-(4-bromophenyl)-5-methyl-1,3-thiazol-2-yl]piperidin-1-yl]-N-(4,5-dimethyl-2-nitrophenyl)-4-oxobut-2-enamide |
| SMILES | Cc1cc(NC(=O)C=CC(=O)N2CCC(c3nc(-c4ccc(Br)cc4)c(C)s3)CC2)c([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C27H27BrN4O4S/c1-16-14-22(23(32(35)36)15-17(16)2)29-24(33)8-9-25(34)31-12-10-20(11-13-31)27-30-26(18(3)37-27)19-4-6-21(28)7-5-19/h4-9,14-15,20H,10-13H2,1-3H3,(H,29,33) |
| InChIKey | PHSQEQBYQQVNEQ-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.51 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|