C25H23N3O4S3 — CID 3778100
ethyl 5-[2-[1-(2,3-dithiophen-2-ylprop-2-enoyl)piperidin-4-yl]-1,3-thiazol-4-yl]-1,2-oxazole-3-carboxylate (PubChem CID 3778100) has the molecular formula C25H23N3O4S3 and a molecular weight of 525.68 g/mol. Its IUPAC name is ethyl 5-[2-[1-(2,3-dithiophen-2-ylprop-2-enoyl)piperidin-4-yl]-1,3-thiazol-4-yl]-1,2-oxazole-3-carboxylate.
| Compound Name | ethyl 5-[2-[1-(2,3-dithiophen-2-ylprop-2-enoyl)piperidin-4-yl]-1,3-thiazol-4-yl]-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 3778100 |
| Molecular Formula | C25H23N3O4S3 |
| Molecular Weight | 525.68 g/mol |
| Exact Mass | 525.09 |
| IUPAC Name | ethyl 5-[2-[1-(2,3-dithiophen-2-ylprop-2-enoyl)piperidin-4-yl]-1,3-thiazol-4-yl]-1,2-oxazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2csc(C3CCN(C(=O)C(=Cc4cccs4)c4cccs4)CC3)n2)on1 |
| InChI | InChI=1S/C25H23N3O4S3/c1-2-31-25(30)19-14-21(32-27-19)20-15-35-23(26-20)16-7-9-28(10-8-16)24(29)18(22-6-4-12-34-22)13-17-5-3-11-33-17/h3-6,11-16H,2,7-10H2,1H3 |
| InChIKey | IYABYTRIEKLJBG-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 85.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.68 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|