C12H15N3O3S — CID 166201928
2-cyclopropyl-N'-[(2S)-oxolane-2-carbonyl]-1,3-thiazole-4-carbohydrazide (PubChem CID 166201928) has the molecular formula C12H15N3O3S and a molecular weight of 281.34 g/mol. Its IUPAC name is 2-cyclopropyl-N'-[(2S)-oxolane-2-carbonyl]-1,3-thiazole-4-carbohydrazide.
| Compound Name | 2-cyclopropyl-N'-[(2S)-oxolane-2-carbonyl]-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 166201928 |
| Molecular Formula | C12H15N3O3S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 2-cyclopropyl-N'-[(2S)-oxolane-2-carbonyl]-1,3-thiazole-4-carbohydrazide |
| SMILES | O=C(NNC(=O)[C@@H]1CCCO1)c1csc(C2CC2)n1 |
| InChI | InChI=1S/C12H15N3O3S/c16-10(8-6-19-12(13-8)7-3-4-7)14-15-11(17)9-2-1-5-18-9/h6-7,9H,1-5H2,(H,14,16)(H,15,17)/t9-/m0/s1 |
| InChIKey | RWMDTWSDIMYZAN-VIFPVBQESA-N |
| XLogP | 0.96 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|