C11H13ClN4O3 — CID 166432062
6-chloro-N'-(oxane-2-carbonyl)pyridazine-3-carbohydrazide (PubChem CID 166432062) has the molecular formula C11H13ClN4O3 and a molecular weight of 284.70 g/mol. Its IUPAC name is 6-chloro-N'-(oxane-2-carbonyl)pyridazine-3-carbohydrazide.
| Compound Name | 6-chloro-N'-(oxane-2-carbonyl)pyridazine-3-carbohydrazide |
|---|---|
| PubChem CID | 166432062 |
| Molecular Formula | C11H13ClN4O3 |
| Molecular Weight | 284.70 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 6-chloro-N'-(oxane-2-carbonyl)pyridazine-3-carbohydrazide |
| SMILES | O=C(NNC(=O)C1CCCCO1)c1ccc(Cl)nn1 |
| InChI | InChI=1S/C11H13ClN4O3/c12-9-5-4-7(13-14-9)10(17)15-16-11(18)8-3-1-2-6-19-8/h4-5,8H,1-3,6H2,(H,15,17)(H,16,18) |
| InChIKey | SGKQYGOFJPGXQH-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.70 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|