C11H13N3O3 — CID 7405767
N'-[(2S)-oxolane-2-carbonyl]pyridine-2-carbohydrazide (PubChem CID 7405767) has the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. Its IUPAC name is N'-[(2S)-oxolane-2-carbonyl]pyridine-2-carbohydrazide.
| Compound Name | N'-[(2S)-oxolane-2-carbonyl]pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 7405767 |
| Molecular Formula | C11H13N3O3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | N'-[(2S)-oxolane-2-carbonyl]pyridine-2-carbohydrazide |
| SMILES | O=C(NNC(=O)[C@@H]1CCCO1)c1ccccn1 |
| InChI | InChI=1S/C11H13N3O3/c15-10(8-4-1-2-6-12-8)13-14-11(16)9-5-3-7-17-9/h1-2,4,6,9H,3,5,7H2,(H,13,15)(H,14,16)/t9-/m0/s1 |
| InChIKey | YWXPDYAGMCHZKP-VIFPVBQESA-N |
| XLogP | 0.02 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|