C13H16N2O3 — CID 40870131
(2S)-N'-(4-methylbenzoyl)oxolane-2-carbohydrazide (PubChem CID 40870131) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is (2S)-N'-(4-methylbenzoyl)oxolane-2-carbohydrazide.
| Compound Name | (2S)-N'-(4-methylbenzoyl)oxolane-2-carbohydrazide |
|---|---|
| PubChem CID | 40870131 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | (2S)-N'-(4-methylbenzoyl)oxolane-2-carbohydrazide |
| SMILES | Cc1ccc(C(=O)NNC(=O)[C@@H]2CCCO2)cc1 |
| InChI | InChI=1S/C13H16N2O3/c1-9-4-6-10(7-5-9)12(16)14-15-13(17)11-3-2-8-18-11/h4-7,11H,2-3,8H2,1H3,(H,14,16)(H,15,17)/t11-/m0/s1 |
| InChIKey | JRSKYWNMMDOTEE-NSHDSACASA-N |
| XLogP | 0.94 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|