C22H21N3O3 — CID 43005524
2-(4-methylphenyl)-N'-(oxolane-2-carbonyl)quinoline-4-carbohydrazide (PubChem CID 43005524) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is 2-(4-methylphenyl)-N'-(oxolane-2-carbonyl)quinoline-4-carbohydrazide.
| Compound Name | 2-(4-methylphenyl)-N'-(oxolane-2-carbonyl)quinoline-4-carbohydrazide |
|---|---|
| PubChem CID | 43005524 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 2-(4-methylphenyl)-N'-(oxolane-2-carbonyl)quinoline-4-carbohydrazide |
| SMILES | Cc1ccc(-c2cc(C(=O)NNC(=O)C3CCCO3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C22H21N3O3/c1-14-8-10-15(11-9-14)19-13-17(16-5-2-3-6-18(16)23-19)21(26)24-25-22(27)20-7-4-12-28-20/h2-3,5-6,8-11,13,20H,4,7,12H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | CAMUUTMMYMQDBS-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|