C27H22N4O3 — CID 55508001
2-(4-methylphenyl)-N'-(2-oxo-3,4-dihydro-1H-quinoline-4-carbonyl)quinoline-4-carbohydrazide (PubChem CID 55508001) has the molecular formula C27H22N4O3 and a molecular weight of 450.50 g/mol. Its IUPAC name is 2-(4-methylphenyl)-N'-(2-oxo-3,4-dihydro-1H-quinoline-4-carbonyl)quinoline-4-carbohydrazide.
| Compound Name | 2-(4-methylphenyl)-N'-(2-oxo-3,4-dihydro-1H-quinoline-4-carbonyl)quinoline-4-carbohydrazide |
|---|---|
| PubChem CID | 55508001 |
| Molecular Formula | C27H22N4O3 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | 2-(4-methylphenyl)-N'-(2-oxo-3,4-dihydro-1H-quinoline-4-carbonyl)quinoline-4-carbohydrazide |
| SMILES | Cc1ccc(-c2cc(C(=O)NNC(=O)C3CC(=O)Nc4ccccc43)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C27H22N4O3/c1-16-10-12-17(13-11-16)24-14-20(18-6-2-4-8-22(18)28-24)26(33)30-31-27(34)21-15-25(32)29-23-9-5-3-7-19(21)23/h2-14,21H,15H2,1H3,(H,29,32)(H,30,33)(H,31,34) |
| InChIKey | MJOMTCJDXGHBJM-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|