C23H24N4O2 — CID 3285527
1-cyclohexyl-3-[(2-phenylquinoline-4-carbonyl)amino]urea (PubChem CID 3285527) has the molecular formula C23H24N4O2 and a molecular weight of 388.47 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(2-phenylquinoline-4-carbonyl)amino]urea.
| Compound Name | 1-cyclohexyl-3-[(2-phenylquinoline-4-carbonyl)amino]urea |
|---|---|
| PubChem CID | 3285527 |
| Molecular Formula | C23H24N4O2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 1-cyclohexyl-3-[(2-phenylquinoline-4-carbonyl)amino]urea |
| SMILES | O=C(NNC(=O)c1cc(-c2ccccc2)nc2ccccc12)NC1CCCCC1 |
| InChI | InChI=1S/C23H24N4O2/c28-22(26-27-23(29)24-17-11-5-2-6-12-17)19-15-21(16-9-3-1-4-10-16)25-20-14-8-7-13-18(19)20/h1,3-4,7-10,13-15,17H,2,5-6,11-12H2,(H,26,28)(H2,24,27,29) |
| InChIKey | PTARHEQAXYMPHR-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|