C28H24N4O2 — CID 154840806
1-(1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalen-1-yl)-3-[(2-phenylquinoline-4-carbonyl)amino]urea (PubChem CID 154840806) has the molecular formula C28H24N4O2 and a molecular weight of 448.53 g/mol. Its IUPAC name is 1-(1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalen-1-yl)-3-[(2-phenylquinoline-4-carbonyl)amino]urea.
| Compound Name | 1-(1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalen-1-yl)-3-[(2-phenylquinoline-4-carbonyl)amino]urea |
|---|---|
| PubChem CID | 154840806 |
| Molecular Formula | C28H24N4O2 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | 1-(1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalen-1-yl)-3-[(2-phenylquinoline-4-carbonyl)amino]urea |
| SMILES | O=C(NNC(=O)c1cc(-c2ccccc2)nc2ccccc12)NC1C2CCc3ccccc3C21 |
| InChI | InChI=1S/C28H24N4O2/c33-27(22-16-24(18-9-2-1-3-10-18)29-23-13-7-6-12-20(22)23)31-32-28(34)30-26-21-15-14-17-8-4-5-11-19(17)25(21)26/h1-13,16,21,25-26H,14-15H2,(H,31,33)(H2,30,32,34) |
| InChIKey | SLVQCBOZYLTPOL-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|