C27H21N5O3 — CID 23474473
N'-(6-oxo-1-phenyl-4,5-dihydropyridazine-3-carbonyl)-2-phenylquinoline-4-carbohydrazide (PubChem CID 23474473) has the molecular formula C27H21N5O3 and a molecular weight of 463.50 g/mol. Its IUPAC name is N'-(6-oxo-1-phenyl-4,5-dihydropyridazine-3-carbonyl)-2-phenylquinoline-4-carbohydrazide.
| Compound Name | N'-(6-oxo-1-phenyl-4,5-dihydropyridazine-3-carbonyl)-2-phenylquinoline-4-carbohydrazide |
|---|---|
| PubChem CID | 23474473 |
| Molecular Formula | C27H21N5O3 |
| Molecular Weight | 463.50 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | N'-(6-oxo-1-phenyl-4,5-dihydropyridazine-3-carbonyl)-2-phenylquinoline-4-carbohydrazide |
| SMILES | O=C(NNC(=O)c1cc(-c2ccccc2)nc2ccccc12)C1=NN(c2ccccc2)C(=O)CC1 |
| InChI | InChI=1S/C27H21N5O3/c33-25-16-15-23(31-32(25)19-11-5-2-6-12-19)27(35)30-29-26(34)21-17-24(18-9-3-1-4-10-18)28-22-14-8-7-13-20(21)22/h1-14,17H,15-16H2,(H,29,34)(H,30,35) |
| InChIKey | QUHSBLIYZZZPFG-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.50 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|