C16H18N4O3 — CID 60556519
5-methyl-N'-(oxolane-2-carbonyl)-1-phenylpyrazole-3-carbohydrazide (PubChem CID 60556519) has the molecular formula C16H18N4O3 and a molecular weight of 314.34 g/mol. Its IUPAC name is 5-methyl-N'-(oxolane-2-carbonyl)-1-phenylpyrazole-3-carbohydrazide.
| Compound Name | 5-methyl-N'-(oxolane-2-carbonyl)-1-phenylpyrazole-3-carbohydrazide |
|---|---|
| PubChem CID | 60556519 |
| Molecular Formula | C16H18N4O3 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 5-methyl-N'-(oxolane-2-carbonyl)-1-phenylpyrazole-3-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNC(=O)C2CCCO2)nn1-c1ccccc1 |
| InChI | InChI=1S/C16H18N4O3/c1-11-10-13(19-20(11)12-6-3-2-4-7-12)15(21)17-18-16(22)14-8-5-9-23-14/h2-4,6-7,10,14H,5,8-9H2,1H3,(H,17,21)(H,18,22) |
| InChIKey | OCOCKRONRDOADY-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|