C12H16BrNO2S — CID 125499503
ethyl 4-(4-bromo-1,3-thiazol-2-yl)cyclohexane-1-carboxylate (PubChem CID 125499503) has the molecular formula C12H16BrNO2S and a molecular weight of 318.24 g/mol. Its IUPAC name is ethyl 4-(4-bromo-1,3-thiazol-2-yl)cyclohexane-1-carboxylate.
| Compound Name | ethyl 4-(4-bromo-1,3-thiazol-2-yl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 125499503 |
| Molecular Formula | C12H16BrNO2S |
| Molecular Weight | 318.24 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | ethyl 4-(4-bromo-1,3-thiazol-2-yl)cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(c2nc(Br)cs2)CC1 |
| InChI | InChI=1S/C12H16BrNO2S/c1-2-16-12(15)9-5-3-8(4-6-9)11-14-10(13)7-17-11/h7-9H,2-6H2,1H3 |
| InChIKey | KHXUIRPXNXIHPZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.24 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |