C9H11FN2O2S — CID 156738991
fluoro 2-piperidin-4-yl-1,3-thiazole-4-carboxylate (PubChem CID 156738991) has the molecular formula C9H11FN2O2S and a molecular weight of 230.26 g/mol. Its IUPAC name is fluoro 2-piperidin-4-yl-1,3-thiazole-4-carboxylate.
| Compound Name | fluoro 2-piperidin-4-yl-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 156738991 |
| Molecular Formula | C9H11FN2O2S |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | fluoro 2-piperidin-4-yl-1,3-thiazole-4-carboxylate |
| SMILES | O=C(OF)c1csc(C2CCNCC2)n1 |
| InChI | InChI=1S/C9H11FN2O2S/c10-14-9(13)7-5-15-8(12-7)6-1-3-11-4-2-6/h5-6,11H,1-4H2 |
| InChIKey | AKVFYFYZFNBXAU-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |