C13H20ClFN2 — CID 176569792
7-chloro-6-fluoro-3-(1,2,3,6-tetrahydropyridin-5-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole (PubChem CID 176569792) has the molecular formula C13H20ClFN2 and a molecular weight of 258.77 g/mol. Its IUPAC name is 7-chloro-6-fluoro-3-(1,2,3,6-tetrahydropyridin-5-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole.
| Compound Name | 7-chloro-6-fluoro-3-(1,2,3,6-tetrahydropyridin-5-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole |
|---|---|
| PubChem CID | 176569792 |
| Molecular Formula | C13H20ClFN2 |
| Molecular Weight | 258.77 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 7-chloro-6-fluoro-3-(1,2,3,6-tetrahydropyridin-5-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole |
| SMILES | FC1CCC2C(C3=CCCNC3)CNC2C1Cl |
| InChI | InChI=1S/C13H20ClFN2/c14-12-11(15)4-3-9-10(7-17-13(9)12)8-2-1-5-16-6-8/h2,9-13,16-17H,1,3-7H2 |
| InChIKey | JEEQENXBRPEIMI-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.77 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|