About (2S)-6-azatricyclo[3.2.0.02,4]heptane
(2S)-6-azatricyclo[3.2.0.02,4]heptane (PubChem CID 163535708) has the molecular formula C6H9N
and a molecular weight of 95.15 g/mol. Its IUPAC name is (2S)-6-azatricyclo[3.2.0.02,4]heptane.
Molecular Properties
| Compound Name | (2S)-6-azatricyclo[3.2.0.02,4]heptane |
| PubChem CID | 163535708 |
| Molecular Formula | C6H9N |
| Molecular Weight | 95.15 g/mol |
| Exact Mass | 95.07 |
| IUPAC Name | (2S)-6-azatricyclo[3.2.0.02,4]heptane |
| SMILES | C1NC2C1[C@H]1CC21 |
| InChI | InChI=1S/C6H9N/c1-3-4(1)6-5(3)2-7-6/h3-7H,1-2H2/t3-,4?,5?,6?/m0/s1 |
| InChIKey | DWTVFTSIHWGGBZ-ALMVMMGASA-N |
| XLogP | 0.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 95.15 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2S)-6-azatricyclo[3.2.0.02,4]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-6-azatricyclo[3.2.0.02,4]heptane?
The IUPAC name of (2S)-6-azatricyclo[3.2.0.02,4]heptane (CID 163535708) is (2S)-6-azatricyclo[3.2.0.02,4]heptane.
What is the SMILES notation for (2S)-6-azatricyclo[3.2.0.02,4]heptane?
The canonical SMILES for (2S)-6-azatricyclo[3.2.0.02,4]heptane is C1NC2C1[C@H]1CC21.
What is the InChIKey of (2S)-6-azatricyclo[3.2.0.02,4]heptane?
The InChIKey is DWTVFTSIHWGGBZ-ALMVMMGASA-N. The full InChI is InChI=1S/C6H9N/c1-3-4(1)6-5(3)2-7-6/h3-7H,1-2H2/t3-,4?,5?,6?/m0/s1.
What are the key properties of (2S)-6-azatricyclo[3.2.0.02,4]heptane?
(2S)-6-azatricyclo[3.2.0.02,4]heptane has a molecular weight of 95.15 g/mol, XLogP of 0.22, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-6-azatricyclo[3.2.0.02,4]heptane is sourced from PubChem (CID 163535708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).