About 7-azatricyclo[4.3.0.03,9]nonane
7-azatricyclo[4.3.0.03,9]nonane (PubChem CID 45092436) has the molecular formula C8H13N
and a molecular weight of 123.20 g/mol. Its IUPAC name is 7-azatricyclo[4.3.0.03,9]nonane.
Molecular Properties
| Compound Name | 7-azatricyclo[4.3.0.03,9]nonane |
| PubChem CID | 45092436 |
| Molecular Formula | C8H13N |
| Molecular Weight | 123.20 g/mol |
| Exact Mass | 123.10 |
| IUPAC Name | 7-azatricyclo[4.3.0.03,9]nonane |
| SMILES | C1CC2NCC3C1CC23 |
| InChI | InChI=1S/C8H13N/c1-2-8-6-3-5(1)7(6)4-9-8/h5-9H,1-4H2 |
| InChIKey | NGQBNOBTEYCVBX-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.20 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-azatricyclo[4.3.0.03,9]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-azatricyclo[4.3.0.03,9]nonane?
The IUPAC name of 7-azatricyclo[4.3.0.03,9]nonane (CID 45092436) is 7-azatricyclo[4.3.0.03,9]nonane.
What is the SMILES notation for 7-azatricyclo[4.3.0.03,9]nonane?
The canonical SMILES for 7-azatricyclo[4.3.0.03,9]nonane is C1CC2NCC3C1CC23.
What is the InChIKey of 7-azatricyclo[4.3.0.03,9]nonane?
The InChIKey is NGQBNOBTEYCVBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N/c1-2-8-6-3-5(1)7(6)4-9-8/h5-9H,1-4H2.
What are the key properties of 7-azatricyclo[4.3.0.03,9]nonane?
7-azatricyclo[4.3.0.03,9]nonane has a molecular weight of 123.20 g/mol, XLogP of 1.00, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-azatricyclo[4.3.0.03,9]nonane is sourced from PubChem (CID 45092436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).